(4,4-Difluorocyclohexyl)methanol
Catalog No: FT-0684563
CAS No: 178312-48-6
- Chemical Name: (4,4-Difluorocyclohexyl)methanol
- Molecular Formula: C7H12F2O
- Molecular Weight: 150.17
- InChI Key: XJZNZSLOHZLFQP-UHFFFAOYSA-N
- InChI: InChI=1S/C7H12F2O/c8-7(9)3-1-6(5-10)2-4-7/h6,10H,1-5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 150.166 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 178312-48-6 |
| Bolling_Point: | 181.4±10.0 °C at 760 mmHg |
| Product_Name: | (4,4-Difluorocyclohexyl)methanol |
| Melting_Point: | N/A |
| Flash_Point: | 63.5±19.0 °C |
| MF: | C7H12F2O |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 0.49 |
| Flash_Point: | 63.5±19.0 °C |
| Refractive_Index: | 1.421 |
| FW: | 150.166 |
| PSA: | 20.23000 |
| MF: | C7H12F2O |
| Bolling_Point: | 181.4±10.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.3±0.7 mmHg at 25°C |
| Exact_Mass: | 150.085617 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2906199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)